C28H31BFNO3 — CID 70974608
1-benzhydryl-3-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]azetidine (PubChem CID 70974608) has the molecular formula C28H31BFNO3 and a molecular weight of 459.37 g/mol. Its IUPAC name is 1-benzhydryl-3-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]azetidine.
| Compound Name | 1-benzhydryl-3-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]azetidine |
|---|---|
| PubChem CID | 70974608 |
| Molecular Formula | C28H31BFNO3 |
| Molecular Weight | 459.37 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | 1-benzhydryl-3-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]azetidine |
| SMILES | CC1(C)OB(c2ccc(OC3CN(C(c4ccccc4)c4ccccc4)C3)c(F)c2)OC1(C)C |
| InChI | InChI=1S/C28H31BFNO3/c1-27(2)28(3,4)34-29(33-27)22-15-16-25(24(30)17-22)32-23-18-31(19-23)26(20-11-7-5-8-12-20)21-13-9-6-10-14-21/h5-17,23,26H,18-19H2,1-4H3 |
| InChIKey | COKPSBZCCZFSKY-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.37 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|