C16H22FN3OS — CID 70975197
N-[2-(4-fluorophenyl)-2-methylpropyl]-3-(3-methoxypropyl)-1,2,4-thiadiazol-5-amine (PubChem CID 70975197) has the molecular formula C16H22FN3OS and a molecular weight of 323.44 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)-2-methylpropyl]-3-(3-methoxypropyl)-1,2,4-thiadiazol-5-amine.
| Compound Name | N-[2-(4-fluorophenyl)-2-methylpropyl]-3-(3-methoxypropyl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 70975197 |
| Molecular Formula | C16H22FN3OS |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | N-[2-(4-fluorophenyl)-2-methylpropyl]-3-(3-methoxypropyl)-1,2,4-thiadiazol-5-amine |
| SMILES | COCCCc1nsc(NCC(C)(C)c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C16H22FN3OS/c1-16(2,12-6-8-13(17)9-7-12)11-18-15-19-14(20-22-15)5-4-10-21-3/h6-9H,4-5,10-11H2,1-3H3,(H,18,19,20) |
| InChIKey | OLXWAOGXXZGDLP-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|