About 3,3-bis(4-aminocyclohexyl)propane-1,2-diamine
3,3-bis(4-aminocyclohexyl)propane-1,2-diamine (PubChem CID 70975749) has the molecular formula C15H32N4
and a molecular weight of 268.45 g/mol. Its IUPAC name is 3,3-bis(4-aminocyclohexyl)propane-1,2-diamine.
Molecular Properties
| Compound Name | 3,3-bis(4-aminocyclohexyl)propane-1,2-diamine |
| PubChem CID | 70975749 |
| Molecular Formula | C15H32N4 |
| Molecular Weight | 268.45 g/mol |
| Exact Mass | 268.26 |
| IUPAC Name | 3,3-bis(4-aminocyclohexyl)propane-1,2-diamine |
| SMILES | NCC(N)C(C1CCC(N)CC1)C1CCC(N)CC1 |
| InChI | InChI=1S/C15H32N4/c16-9-14(19)15(10-1-5-12(17)6-2-10)11-3-7-13(18)8-4-11/h10-15H,1-9,16-19H2 |
| InChIKey | XBQPWSYLBVHXFV-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.45 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,3-bis(4-aminocyclohexyl)propane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-bis(4-aminocyclohexyl)propane-1,2-diamine?
The IUPAC name of 3,3-bis(4-aminocyclohexyl)propane-1,2-diamine (CID 70975749) is 3,3-bis(4-aminocyclohexyl)propane-1,2-diamine.
What is the SMILES notation for 3,3-bis(4-aminocyclohexyl)propane-1,2-diamine?
The canonical SMILES for 3,3-bis(4-aminocyclohexyl)propane-1,2-diamine is NCC(N)C(C1CCC(N)CC1)C1CCC(N)CC1.
What is the InChIKey of 3,3-bis(4-aminocyclohexyl)propane-1,2-diamine?
The InChIKey is XBQPWSYLBVHXFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32N4/c16-9-14(19)15(10-1-5-12(17)6-2-10)11-3-7-13(18)8-4-11/h10-15H,1-9,16-19H2.
What are the key properties of 3,3-bis(4-aminocyclohexyl)propane-1,2-diamine?
3,3-bis(4-aminocyclohexyl)propane-1,2-diamine has a molecular weight of 268.45 g/mol, XLogP of 0.92, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-bis(4-aminocyclohexyl)propane-1,2-diamine is sourced from PubChem (CID 70975749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).