C19H17F4N3O4S — CID 70975861
N-[(6R,7aS)-3-oxo-2-[4-(trifluoromethoxy)phenyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-6-yl]-2-fluorobenzenesulfonamide (PubChem CID 70975861) has the molecular formula C19H17F4N3O4S and a molecular weight of 459.42 g/mol. Its IUPAC name is N-[(6R,7aS)-3-oxo-2-[4-(trifluoromethoxy)phenyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-6-yl]-2-fluorobenzenesulfonamide.
| Compound Name | N-[(6R,7aS)-3-oxo-2-[4-(trifluoromethoxy)phenyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-6-yl]-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 70975861 |
| Molecular Formula | C19H17F4N3O4S |
| Molecular Weight | 459.42 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | N-[(6R,7aS)-3-oxo-2-[4-(trifluoromethoxy)phenyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-6-yl]-2-fluorobenzenesulfonamide |
| SMILES | O=C1N(c2ccc(OC(F)(F)F)cc2)C[C@@H]2C[C@@H](NS(=O)(=O)c3ccccc3F)CN12 |
| InChI | InChI=1S/C19H17F4N3O4S/c20-16-3-1-2-4-17(16)31(28,29)24-12-9-14-11-26(18(27)25(14)10-12)13-5-7-15(8-6-13)30-19(21,22)23/h1-8,12,14,24H,9-11H2/t12-,14+/m1/s1 |
| InChIKey | OWTIXMFGKYOTLR-OCCSQVGLSA-N |
| XLogP | 3.09 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |