C17H25BClNO3 — CID 70975923
N-[4-chloro-2-(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)phenyl]-2,2-dimethylpropanamide (PubChem CID 70975923) has the molecular formula C17H25BClNO3 and a molecular weight of 337.66 g/mol. Its IUPAC name is N-[4-chloro-2-(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)phenyl]-2,2-dimethylpropanamide.
| Compound Name | N-[4-chloro-2-(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)phenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 70975923 |
| Molecular Formula | C17H25BClNO3 |
| Molecular Weight | 337.66 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | N-[4-chloro-2-(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)phenyl]-2,2-dimethylpropanamide |
| SMILES | CC1CC(C)(C)OB(c2cc(Cl)ccc2NC(=O)C(C)(C)C)O1 |
| InChI | InChI=1S/C17H25BClNO3/c1-11-10-17(5,6)23-18(22-11)13-9-12(19)7-8-14(13)20-15(21)16(2,3)4/h7-9,11H,10H2,1-6H3,(H,20,21) |
| InChIKey | JQIUYMBMKYUDLK-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.66 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|