C18H23F3N2O4S — CID 70975954
(6R,7aS)-6-(3-methylbutylsulfonyl)-2-[4-(trifluoromethoxy)phenyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-3-one (PubChem CID 70975954) has the molecular formula C18H23F3N2O4S and a molecular weight of 420.45 g/mol. Its IUPAC name is (6R,7aS)-6-(3-methylbutylsulfonyl)-2-[4-(trifluoromethoxy)phenyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-3-one.
| Compound Name | (6R,7aS)-6-(3-methylbutylsulfonyl)-2-[4-(trifluoromethoxy)phenyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-3-one |
|---|---|
| PubChem CID | 70975954 |
| Molecular Formula | C18H23F3N2O4S |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | (6R,7aS)-6-(3-methylbutylsulfonyl)-2-[4-(trifluoromethoxy)phenyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-3-one |
| SMILES | CC(C)CCS(=O)(=O)[C@@H]1C[C@H]2CN(c3ccc(OC(F)(F)F)cc3)C(=O)N2C1 |
| InChI | InChI=1S/C18H23F3N2O4S/c1-12(2)7-8-28(25,26)16-9-14-10-22(17(24)23(14)11-16)13-3-5-15(6-4-13)27-18(19,20)21/h3-6,12,14,16H,7-11H2,1-2H3/t14-,16+/m0/s1 |
| InChIKey | SEPFOGBCLAGUQI-GOEBONIOSA-N |
| XLogP | 3.43 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |