C19H24F3N3O3 — CID 70976059
N-[(6R,7aS)-3-oxo-2-[4-(trifluoromethoxy)phenyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-6-yl]-3,3-dimethylbutanamide (PubChem CID 70976059) has the molecular formula C19H24F3N3O3 and a molecular weight of 399.41 g/mol. Its IUPAC name is N-[(6R,7aS)-3-oxo-2-[4-(trifluoromethoxy)phenyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-6-yl]-3,3-dimethylbutanamide.
| Compound Name | N-[(6R,7aS)-3-oxo-2-[4-(trifluoromethoxy)phenyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-6-yl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 70976059 |
| Molecular Formula | C19H24F3N3O3 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | N-[(6R,7aS)-3-oxo-2-[4-(trifluoromethoxy)phenyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-6-yl]-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)CC(=O)N[C@@H]1C[C@H]2CN(c3ccc(OC(F)(F)F)cc3)C(=O)N2C1 |
| InChI | InChI=1S/C19H24F3N3O3/c1-18(2,3)9-16(26)23-12-8-14-11-25(17(27)24(14)10-12)13-4-6-15(7-5-13)28-19(20,21)22/h4-7,12,14H,8-11H2,1-3H3,(H,23,26)/t12-,14+/m1/s1 |
| InChIKey | BSVABMIZHVJGOW-OCCSQVGLSA-N |
| XLogP | 3.52 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |