About 2-(3,5-difluorophenyl)-N-[4-(3-methylthiophen-2-yl)-1-oxophthalazin-2-yl]acetamide
2-(3,5-difluorophenyl)-N-[4-(3-methylthiophen-2-yl)-1-oxophthalazin-2-yl]acetamide (PubChem CID 70976097) has the molecular formula C21H15F2N3O2S
and a molecular weight of 411.43 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)-N-[4-(3-methylthiophen-2-yl)-1-oxophthalazin-2-yl]acetamide.
Molecular Properties
| Compound Name | 2-(3,5-difluorophenyl)-N-[4-(3-methylthiophen-2-yl)-1-oxophthalazin-2-yl]acetamide |
| PubChem CID | 70976097 |
| Molecular Formula | C21H15F2N3O2S |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | 2-(3,5-difluorophenyl)-N-[4-(3-methylthiophen-2-yl)-1-oxophthalazin-2-yl]acetamide |
| SMILES | Cc1ccsc1-c1nn(NC(=O)Cc2cc(F)cc(F)c2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C21H15F2N3O2S/c1-12-6-7-29-20(12)19-16-4-2-3-5-17(16)21(28)26(25-19)24-18(27)10-13-8-14(22)11-15(23)9-13/h2-9,11H,10H2,1H3,(H,24,27) |
| InChIKey | WBQOHYLIYSNSGC-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(3,5-difluorophenyl)-N-[4-(3-methylthiophen-2-yl)-1-oxophthalazin-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-difluorophenyl)-N-[4-(3-methylthiophen-2-yl)-1-oxophthalazin-2-yl]acetamide?
The IUPAC name of 2-(3,5-difluorophenyl)-N-[4-(3-methylthiophen-2-yl)-1-oxophthalazin-2-yl]acetamide (CID 70976097) is 2-(3,5-difluorophenyl)-N-[4-(3-methylthiophen-2-yl)-1-oxophthalazin-2-yl]acetamide.
What is the SMILES notation for 2-(3,5-difluorophenyl)-N-[4-(3-methylthiophen-2-yl)-1-oxophthalazin-2-yl]acetamide?
The canonical SMILES for 2-(3,5-difluorophenyl)-N-[4-(3-methylthiophen-2-yl)-1-oxophthalazin-2-yl]acetamide is Cc1ccsc1-c1nn(NC(=O)Cc2cc(F)cc(F)c2)c(=O)c2ccccc12.
What is the InChIKey of 2-(3,5-difluorophenyl)-N-[4-(3-methylthiophen-2-yl)-1-oxophthalazin-2-yl]acetamide?
The InChIKey is WBQOHYLIYSNSGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15F2N3O2S/c1-12-6-7-29-20(12)19-16-4-2-3-5-17(16)21(28)26(25-19)24-18(27)10-13-8-14(22)11-15(23)9-13/h2-9,11H,10H2,1H3,(H,24,27).
What are the key properties of 2-(3,5-difluorophenyl)-N-[4-(3-methylthiophen-2-yl)-1-oxophthalazin-2-yl]acetamide?
2-(3,5-difluorophenyl)-N-[4-(3-methylthiophen-2-yl)-1-oxophthalazin-2-yl]acetamide has a molecular weight of 411.43 g/mol, XLogP of 4.02, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-difluorophenyl)-N-[4-(3-methylthiophen-2-yl)-1-oxophthalazin-2-yl]acetamide is sourced from PubChem (CID 70976097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).