C20H20F3N3O4S — CID 70976127
N-[(6S,7aS)-3-oxo-2-[4-(trifluoromethoxy)phenyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-6-yl]-1-phenylmethanesulfonamide (PubChem CID 70976127) has the molecular formula C20H20F3N3O4S and a molecular weight of 455.46 g/mol. Its IUPAC name is N-[(6S,7aS)-3-oxo-2-[4-(trifluoromethoxy)phenyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-6-yl]-1-phenylmethanesulfonamide.
| Compound Name | N-[(6S,7aS)-3-oxo-2-[4-(trifluoromethoxy)phenyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-6-yl]-1-phenylmethanesulfonamide |
|---|---|
| PubChem CID | 70976127 |
| Molecular Formula | C20H20F3N3O4S |
| Molecular Weight | 455.46 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | N-[(6S,7aS)-3-oxo-2-[4-(trifluoromethoxy)phenyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-6-yl]-1-phenylmethanesulfonamide |
| SMILES | O=C1N(c2ccc(OC(F)(F)F)cc2)C[C@@H]2C[C@H](NS(=O)(=O)Cc3ccccc3)CN12 |
| InChI | InChI=1S/C20H20F3N3O4S/c21-20(22,23)30-18-8-6-16(7-9-18)26-12-17-10-15(11-25(17)19(26)27)24-31(28,29)13-14-4-2-1-3-5-14/h1-9,15,17,24H,10-13H2/t15-,17-/m0/s1 |
| InChIKey | DNOYGOXMEVBJIC-RDJZCZTQSA-N |
| XLogP | 3.09 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.46 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |