About 4-(3-methylbutyl)-3-(5-methylhexyl)-1,2-dihydrotriazole
4-(3-methylbutyl)-3-(5-methylhexyl)-1,2-dihydrotriazole (PubChem CID 70976394) has the molecular formula C14H29N3
and a molecular weight of 239.41 g/mol. Its IUPAC name is 4-(3-methylbutyl)-3-(5-methylhexyl)-1,2-dihydrotriazole.
Molecular Properties
| Compound Name | 4-(3-methylbutyl)-3-(5-methylhexyl)-1,2-dihydrotriazole |
| PubChem CID | 70976394 |
| Molecular Formula | C14H29N3 |
| Molecular Weight | 239.41 g/mol |
| Exact Mass | 239.24 |
| IUPAC Name | 4-(3-methylbutyl)-3-(5-methylhexyl)-1,2-dihydrotriazole |
| SMILES | CC(C)CCCCN1NNC=C1CCC(C)C |
| InChI | InChI=1S/C14H29N3/c1-12(2)7-5-6-10-17-14(11-15-16-17)9-8-13(3)4/h11-13,15-16H,5-10H2,1-4H3 |
| InChIKey | GOSJKYYZURCLDK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.41 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-methylbutyl)-3-(5-methylhexyl)-1,2-dihydrotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-methylbutyl)-3-(5-methylhexyl)-1,2-dihydrotriazole?
The IUPAC name of 4-(3-methylbutyl)-3-(5-methylhexyl)-1,2-dihydrotriazole (CID 70976394) is 4-(3-methylbutyl)-3-(5-methylhexyl)-1,2-dihydrotriazole.
What is the SMILES notation for 4-(3-methylbutyl)-3-(5-methylhexyl)-1,2-dihydrotriazole?
The canonical SMILES for 4-(3-methylbutyl)-3-(5-methylhexyl)-1,2-dihydrotriazole is CC(C)CCCCN1NNC=C1CCC(C)C.
What is the InChIKey of 4-(3-methylbutyl)-3-(5-methylhexyl)-1,2-dihydrotriazole?
The InChIKey is GOSJKYYZURCLDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29N3/c1-12(2)7-5-6-10-17-14(11-15-16-17)9-8-13(3)4/h11-13,15-16H,5-10H2,1-4H3.
What are the key properties of 4-(3-methylbutyl)-3-(5-methylhexyl)-1,2-dihydrotriazole?
4-(3-methylbutyl)-3-(5-methylhexyl)-1,2-dihydrotriazole has a molecular weight of 239.41 g/mol, XLogP of 3.42, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-methylbutyl)-3-(5-methylhexyl)-1,2-dihydrotriazole is sourced from PubChem (CID 70976394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).