About 6-methyl-2-sulfanylidene-1H-pyrimidin-4-one;1-propylsulfanylpyrimidine-2,4-dione
6-methyl-2-sulfanylidene-1H-pyrimidin-4-one;1-propylsulfanylpyrimidine-2,4-dione (PubChem CID 70976639) has the molecular formula C12H16N4O3S2
and a molecular weight of 328.42 g/mol. Its IUPAC name is 6-methyl-2-sulfanylidene-1H-pyrimidin-4-one;1-propylsulfanylpyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 6-methyl-2-sulfanylidene-1H-pyrimidin-4-one;1-propylsulfanylpyrimidine-2,4-dione |
| PubChem CID | 70976639 |
| Molecular Formula | C12H16N4O3S2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 6-methyl-2-sulfanylidene-1H-pyrimidin-4-one;1-propylsulfanylpyrimidine-2,4-dione |
| SMILES | CCCSn1ccc(=O)[nH]c1=O.Cc1cc(=O)[nH]c(=S)[nH]1 |
| InChI | InChI=1S/C7H10N2O2S.C5H6N2OS/c1-2-5-12-9-4-3-6(10)8-7(9)11;1-3-2-4(8)7-5(9)6-3/h3-4H,2,5H2,1H3,(H,8,10,11);2H,1H3,(H2,6,7,8,9) |
| InChIKey | QYLDZPZMJHFYII-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 103.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-2-sulfanylidene-1H-pyrimidin-4-one;1-propylsulfanylpyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2-sulfanylidene-1H-pyrimidin-4-one;1-propylsulfanylpyrimidine-2,4-dione?
The IUPAC name of 6-methyl-2-sulfanylidene-1H-pyrimidin-4-one;1-propylsulfanylpyrimidine-2,4-dione (CID 70976639) is 6-methyl-2-sulfanylidene-1H-pyrimidin-4-one;1-propylsulfanylpyrimidine-2,4-dione.
What is the SMILES notation for 6-methyl-2-sulfanylidene-1H-pyrimidin-4-one;1-propylsulfanylpyrimidine-2,4-dione?
The canonical SMILES for 6-methyl-2-sulfanylidene-1H-pyrimidin-4-one;1-propylsulfanylpyrimidine-2,4-dione is CCCSn1ccc(=O)[nH]c1=O.Cc1cc(=O)[nH]c(=S)[nH]1.
What is the InChIKey of 6-methyl-2-sulfanylidene-1H-pyrimidin-4-one;1-propylsulfanylpyrimidine-2,4-dione?
The InChIKey is QYLDZPZMJHFYII-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2S.C5H6N2OS/c1-2-5-12-9-4-3-6(10)8-7(9)11;1-3-2-4(8)7-5(9)6-3/h3-4H,2,5H2,1H3,(H,8,10,11);2H,1H3,(H2,6,7,8,9).
What are the key properties of 6-methyl-2-sulfanylidene-1H-pyrimidin-4-one;1-propylsulfanylpyrimidine-2,4-dione?
6-methyl-2-sulfanylidene-1H-pyrimidin-4-one;1-propylsulfanylpyrimidine-2,4-dione has a molecular weight of 328.42 g/mol, XLogP of 1.18, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2-sulfanylidene-1H-pyrimidin-4-one;1-propylsulfanylpyrimidine-2,4-dione is sourced from PubChem (CID 70976639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).