C11H17FN6O — CID 70976744
[1-(2-amino-5-fluoropyrimidin-4-yl)piperidin-4-yl]methylurea (PubChem CID 70976744) has the molecular formula C11H17FN6O and a molecular weight of 268.30 g/mol. Its IUPAC name is [1-(2-amino-5-fluoropyrimidin-4-yl)piperidin-4-yl]methylurea.
| Compound Name | [1-(2-amino-5-fluoropyrimidin-4-yl)piperidin-4-yl]methylurea |
|---|---|
| PubChem CID | 70976744 |
| Molecular Formula | C11H17FN6O |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | [1-(2-amino-5-fluoropyrimidin-4-yl)piperidin-4-yl]methylurea |
| SMILES | NC(=O)NCC1CCN(c2nc(N)ncc2F)CC1 |
| InChI | InChI=1S/C11H17FN6O/c12-8-6-15-10(13)17-9(8)18-3-1-7(2-4-18)5-16-11(14)19/h6-7H,1-5H2,(H2,13,15,17)(H3,14,16,19) |
| InChIKey | JWTFXJAKWNJKGB-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |