About 1,2-difluoro-3-(2-fluorophenyl)benzene;methanol
1,2-difluoro-3-(2-fluorophenyl)benzene;methanol (PubChem CID 70977056) has the molecular formula C13H11F3O
and a molecular weight of 240.22 g/mol. Its IUPAC name is 1,2-difluoro-3-(2-fluorophenyl)benzene;methanol.
Molecular Properties
| Compound Name | 1,2-difluoro-3-(2-fluorophenyl)benzene;methanol |
| PubChem CID | 70977056 |
| Molecular Formula | C13H11F3O |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 1,2-difluoro-3-(2-fluorophenyl)benzene;methanol |
| SMILES | CO.Fc1ccccc1-c1cccc(F)c1F |
| InChI | InChI=1S/C12H7F3.CH4O/c13-10-6-2-1-4-8(10)9-5-3-7-11(14)12(9)15;1-2/h1-7H;2H,1H3 |
| InChIKey | LORASCDTUYCPPX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,2-difluoro-3-(2-fluorophenyl)benzene;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-difluoro-3-(2-fluorophenyl)benzene;methanol?
The IUPAC name of 1,2-difluoro-3-(2-fluorophenyl)benzene;methanol (CID 70977056) is 1,2-difluoro-3-(2-fluorophenyl)benzene;methanol.
What is the SMILES notation for 1,2-difluoro-3-(2-fluorophenyl)benzene;methanol?
The canonical SMILES for 1,2-difluoro-3-(2-fluorophenyl)benzene;methanol is CO.Fc1ccccc1-c1cccc(F)c1F.
What is the InChIKey of 1,2-difluoro-3-(2-fluorophenyl)benzene;methanol?
The InChIKey is LORASCDTUYCPPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7F3.CH4O/c13-10-6-2-1-4-8(10)9-5-3-7-11(14)12(9)15;1-2/h1-7H;2H,1H3.
What are the key properties of 1,2-difluoro-3-(2-fluorophenyl)benzene;methanol?
1,2-difluoro-3-(2-fluorophenyl)benzene;methanol has a molecular weight of 240.22 g/mol, XLogP of 3.38, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-difluoro-3-(2-fluorophenyl)benzene;methanol is sourced from PubChem (CID 70977056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).