About 6-(1,3-benzothiazol-6-yl)-N-[2-(1H-imidazol-5-yl)ethyl]-2-methylpyrimidin-4-amine
6-(1,3-benzothiazol-6-yl)-N-[2-(1H-imidazol-5-yl)ethyl]-2-methylpyrimidin-4-amine (PubChem CID 70977686) has the molecular formula C17H16N6S
and a molecular weight of 336.42 g/mol. Its IUPAC name is 6-(1,3-benzothiazol-6-yl)-N-[2-(1H-imidazol-5-yl)ethyl]-2-methylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-(1,3-benzothiazol-6-yl)-N-[2-(1H-imidazol-5-yl)ethyl]-2-methylpyrimidin-4-amine |
| PubChem CID | 70977686 |
| Molecular Formula | C17H16N6S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 6-(1,3-benzothiazol-6-yl)-N-[2-(1H-imidazol-5-yl)ethyl]-2-methylpyrimidin-4-amine |
| SMILES | Cc1nc(NCCc2cnc[nH]2)cc(-c2ccc3ncsc3c2)n1 |
| InChI | InChI=1S/C17H16N6S/c1-11-22-15(12-2-3-14-16(6-12)24-10-21-14)7-17(23-11)19-5-4-13-8-18-9-20-13/h2-3,6-10H,4-5H2,1H3,(H,18,20)(H,19,22,23) |
| InChIKey | WOBCMWKMHYVSPX-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-(1,3-benzothiazol-6-yl)-N-[2-(1H-imidazol-5-yl)ethyl]-2-methylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1,3-benzothiazol-6-yl)-N-[2-(1H-imidazol-5-yl)ethyl]-2-methylpyrimidin-4-amine?
The IUPAC name of 6-(1,3-benzothiazol-6-yl)-N-[2-(1H-imidazol-5-yl)ethyl]-2-methylpyrimidin-4-amine (CID 70977686) is 6-(1,3-benzothiazol-6-yl)-N-[2-(1H-imidazol-5-yl)ethyl]-2-methylpyrimidin-4-amine.
What is the SMILES notation for 6-(1,3-benzothiazol-6-yl)-N-[2-(1H-imidazol-5-yl)ethyl]-2-methylpyrimidin-4-amine?
The canonical SMILES for 6-(1,3-benzothiazol-6-yl)-N-[2-(1H-imidazol-5-yl)ethyl]-2-methylpyrimidin-4-amine is Cc1nc(NCCc2cnc[nH]2)cc(-c2ccc3ncsc3c2)n1.
What is the InChIKey of 6-(1,3-benzothiazol-6-yl)-N-[2-(1H-imidazol-5-yl)ethyl]-2-methylpyrimidin-4-amine?
The InChIKey is WOBCMWKMHYVSPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N6S/c1-11-22-15(12-2-3-14-16(6-12)24-10-21-14)7-17(23-11)19-5-4-13-8-18-9-20-13/h2-3,6-10H,4-5H2,1H3,(H,18,20)(H,19,22,23).
What are the key properties of 6-(1,3-benzothiazol-6-yl)-N-[2-(1H-imidazol-5-yl)ethyl]-2-methylpyrimidin-4-amine?
6-(1,3-benzothiazol-6-yl)-N-[2-(1H-imidazol-5-yl)ethyl]-2-methylpyrimidin-4-amine has a molecular weight of 336.42 g/mol, XLogP of 3.44, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1,3-benzothiazol-6-yl)-N-[2-(1H-imidazol-5-yl)ethyl]-2-methylpyrimidin-4-amine is sourced from PubChem (CID 70977686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).