About 6-bromo-8-chloro-7-fluoro-1,2,3,4-tetrahydroquinoline
6-bromo-8-chloro-7-fluoro-1,2,3,4-tetrahydroquinoline (PubChem CID 70977715) has the molecular formula C9H8BrClFN
and a molecular weight of 264.52 g/mol. Its IUPAC name is 6-bromo-8-chloro-7-fluoro-1,2,3,4-tetrahydroquinoline.
Molecular Properties
| Compound Name | 6-bromo-8-chloro-7-fluoro-1,2,3,4-tetrahydroquinoline |
| PubChem CID | 70977715 |
| Molecular Formula | C9H8BrClFN |
| Molecular Weight | 264.52 g/mol |
| Exact Mass | 262.95 |
| IUPAC Name | 6-bromo-8-chloro-7-fluoro-1,2,3,4-tetrahydroquinoline |
| SMILES | Fc1c(Br)cc2c(c1Cl)NCCC2 |
| InChI | InChI=1S/C9H8BrClFN/c10-6-4-5-2-1-3-13-9(5)7(11)8(6)12/h4,13H,1-3H2 |
| InChIKey | UNTWYFRFJCKKJF-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.52 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-8-chloro-7-fluoro-1,2,3,4-tetrahydroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-8-chloro-7-fluoro-1,2,3,4-tetrahydroquinoline?
The IUPAC name of 6-bromo-8-chloro-7-fluoro-1,2,3,4-tetrahydroquinoline (CID 70977715) is 6-bromo-8-chloro-7-fluoro-1,2,3,4-tetrahydroquinoline.
What is the SMILES notation for 6-bromo-8-chloro-7-fluoro-1,2,3,4-tetrahydroquinoline?
The canonical SMILES for 6-bromo-8-chloro-7-fluoro-1,2,3,4-tetrahydroquinoline is Fc1c(Br)cc2c(c1Cl)NCCC2.
What is the InChIKey of 6-bromo-8-chloro-7-fluoro-1,2,3,4-tetrahydroquinoline?
The InChIKey is UNTWYFRFJCKKJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrClFN/c10-6-4-5-2-1-3-13-9(5)7(11)8(6)12/h4,13H,1-3H2.
What are the key properties of 6-bromo-8-chloro-7-fluoro-1,2,3,4-tetrahydroquinoline?
6-bromo-8-chloro-7-fluoro-1,2,3,4-tetrahydroquinoline has a molecular weight of 264.52 g/mol, XLogP of 3.60, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-8-chloro-7-fluoro-1,2,3,4-tetrahydroquinoline is sourced from PubChem (CID 70977715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).