C27H24FN7O2S — CID 70977748
methyl 5-azido-5-[5-[6-[[4-(fluoromethyl)-2-pyridinyl]amino]-4-methyl-2-pyridinyl]-1,3-thiazol-2-yl]-7,8-dihydro-6H-naphthalene-2-carboxylate (PubChem CID 70977748) has the molecular formula C27H24FN7O2S and a molecular weight of 529.60 g/mol. Its IUPAC name is methyl 5-azido-5-[5-[6-[[4-(fluoromethyl)-2-pyridinyl]amino]-4-methyl-2-pyridinyl]-1,3-thiazol-2-yl]-7,8-dihydro-6H-naphthalene-2-carboxylate.
| Compound Name | methyl 5-azido-5-[5-[6-[[4-(fluoromethyl)-2-pyridinyl]amino]-4-methyl-2-pyridinyl]-1,3-thiazol-2-yl]-7,8-dihydro-6H-naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 70977748 |
| Molecular Formula | C27H24FN7O2S |
| Molecular Weight | 529.60 g/mol |
| Exact Mass | 529.17 |
| IUPAC Name | methyl 5-azido-5-[5-[6-[[4-(fluoromethyl)-2-pyridinyl]amino]-4-methyl-2-pyridinyl]-1,3-thiazol-2-yl]-7,8-dihydro-6H-naphthalene-2-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)CCCC2(N=[N+]=[N-])c1ncc(-c2cc(C)cc(Nc3cc(CF)ccn3)n2)s1 |
| InChI | InChI=1S/C27H24FN7O2S/c1-16-10-21(32-24(11-16)33-23-12-17(14-28)7-9-30-23)22-15-31-26(38-22)27(34-35-29)8-3-4-18-13-19(25(36)37-2)5-6-20(18)27/h5-7,9-13,15H,3-4,8,14H2,1-2H3,(H,30,32,33) |
| InChIKey | OVCYQCXEUCFGTC-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 125.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.60 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|