About 3-[(2S)-2-amino-2-(1,3-oxazolidin-2-yl)propyl]-1H-indol-4-ol
3-[(2S)-2-amino-2-(1,3-oxazolidin-2-yl)propyl]-1H-indol-4-ol (PubChem CID 70977912) has the molecular formula C14H19N3O2
and a molecular weight of 261.32 g/mol. Its IUPAC name is 3-[(2S)-2-amino-2-(1,3-oxazolidin-2-yl)propyl]-1H-indol-4-ol.
Molecular Properties
| Compound Name | 3-[(2S)-2-amino-2-(1,3-oxazolidin-2-yl)propyl]-1H-indol-4-ol |
| PubChem CID | 70977912 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 3-[(2S)-2-amino-2-(1,3-oxazolidin-2-yl)propyl]-1H-indol-4-ol |
| SMILES | C[C@](N)(Cc1c[nH]c2cccc(O)c12)C1NCCO1 |
| InChI | InChI=1S/C14H19N3O2/c1-14(15,13-16-5-6-19-13)7-9-8-17-10-3-2-4-11(18)12(9)10/h2-4,8,13,16-18H,5-7,15H2,1H3/t13?,14-/m0/s1 |
| InChIKey | AORUUEAJGMVHMW-KZUDCZAMSA-N |
| XLogP | 1.08 |
| TPSA | 83.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(2S)-2-amino-2-(1,3-oxazolidin-2-yl)propyl]-1H-indol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2S)-2-amino-2-(1,3-oxazolidin-2-yl)propyl]-1H-indol-4-ol?
The IUPAC name of 3-[(2S)-2-amino-2-(1,3-oxazolidin-2-yl)propyl]-1H-indol-4-ol (CID 70977912) is 3-[(2S)-2-amino-2-(1,3-oxazolidin-2-yl)propyl]-1H-indol-4-ol.
What is the SMILES notation for 3-[(2S)-2-amino-2-(1,3-oxazolidin-2-yl)propyl]-1H-indol-4-ol?
The canonical SMILES for 3-[(2S)-2-amino-2-(1,3-oxazolidin-2-yl)propyl]-1H-indol-4-ol is C[C@](N)(Cc1c[nH]c2cccc(O)c12)C1NCCO1.
What is the InChIKey of 3-[(2S)-2-amino-2-(1,3-oxazolidin-2-yl)propyl]-1H-indol-4-ol?
The InChIKey is AORUUEAJGMVHMW-KZUDCZAMSA-N. The full InChI is InChI=1S/C14H19N3O2/c1-14(15,13-16-5-6-19-13)7-9-8-17-10-3-2-4-11(18)12(9)10/h2-4,8,13,16-18H,5-7,15H2,1H3/t13?,14-/m0/s1.
What are the key properties of 3-[(2S)-2-amino-2-(1,3-oxazolidin-2-yl)propyl]-1H-indol-4-ol?
3-[(2S)-2-amino-2-(1,3-oxazolidin-2-yl)propyl]-1H-indol-4-ol has a molecular weight of 261.32 g/mol, XLogP of 1.08, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2S)-2-amino-2-(1,3-oxazolidin-2-yl)propyl]-1H-indol-4-ol is sourced from PubChem (CID 70977912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).