About 8-butyl-2-sulfanylidene-3,7-dihydropurin-6-one
8-butyl-2-sulfanylidene-3,7-dihydropurin-6-one (PubChem CID 70978513) has the molecular formula C9H12N4OS
and a molecular weight of 224.29 g/mol. Its IUPAC name is 8-butyl-2-sulfanylidene-3,7-dihydropurin-6-one.
Molecular Properties
| Compound Name | 8-butyl-2-sulfanylidene-3,7-dihydropurin-6-one |
| PubChem CID | 70978513 |
| Molecular Formula | C9H12N4OS |
| Molecular Weight | 224.29 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 8-butyl-2-sulfanylidene-3,7-dihydropurin-6-one |
| SMILES | CCCCc1nc2[nH]c(=S)[nH]c(=O)c2[nH]1 |
| InChI | InChI=1S/C9H12N4OS/c1-2-3-4-5-10-6-7(11-5)12-9(15)13-8(6)14/h2-4H2,1H3,(H3,10,11,12,13,14,15) |
| InChIKey | QVVOGUGWQZVCSE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 77.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.29 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 8-butyl-2-sulfanylidene-3,7-dihydropurin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-butyl-2-sulfanylidene-3,7-dihydropurin-6-one?
The IUPAC name of 8-butyl-2-sulfanylidene-3,7-dihydropurin-6-one (CID 70978513) is 8-butyl-2-sulfanylidene-3,7-dihydropurin-6-one.
What is the SMILES notation for 8-butyl-2-sulfanylidene-3,7-dihydropurin-6-one?
The canonical SMILES for 8-butyl-2-sulfanylidene-3,7-dihydropurin-6-one is CCCCc1nc2[nH]c(=S)[nH]c(=O)c2[nH]1.
What is the InChIKey of 8-butyl-2-sulfanylidene-3,7-dihydropurin-6-one?
The InChIKey is QVVOGUGWQZVCSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4OS/c1-2-3-4-5-10-6-7(11-5)12-9(15)13-8(6)14/h2-4H2,1H3,(H3,10,11,12,13,14,15).
What are the key properties of 8-butyl-2-sulfanylidene-3,7-dihydropurin-6-one?
8-butyl-2-sulfanylidene-3,7-dihydropurin-6-one has a molecular weight of 224.29 g/mol, XLogP of 1.65, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-butyl-2-sulfanylidene-3,7-dihydropurin-6-one is sourced from PubChem (CID 70978513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).