C9H12N4OS — CID 70978513
8-butyl-2-sulfanylidene-3,7-dihydropurin-6-one (PubChem CID 70978513) has the molecular formula C9H12N4OS and a molecular weight of 224.29 g/mol. Its IUPAC name is 8-butyl-2-sulfanylidene-3,7-dihydropurin-6-one.
| Compound Name | 8-butyl-2-sulfanylidene-3,7-dihydropurin-6-one |
|---|---|
| PubChem CID | 70978513 |
| Molecular Formula | C9H12N4OS |
| Molecular Weight | 224.29 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 8-butyl-2-sulfanylidene-3,7-dihydropurin-6-one |
| SMILES | CCCCc1nc2[nH]c(=S)[nH]c(=O)c2[nH]1 |
| InChI | InChI=1S/C9H12N4OS/c1-2-3-4-5-10-6-7(11-5)12-9(15)13-8(6)14/h2-4H2,1H3,(H3,10,11,12,13,14,15) |
| InChIKey | QVVOGUGWQZVCSE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 77.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.29 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|