C29H27F3N4O3S — CID 70978677
N-[4-[(2R)-2-methyl-4-[2-(3,4,5-trifluorophenyl)ethyl]piperazine-1-carbonyl]phenyl]quinoline-8-sulfonamide (PubChem CID 70978677) has the molecular formula C29H27F3N4O3S and a molecular weight of 568.62 g/mol. Its IUPAC name is N-[4-[(2R)-2-methyl-4-[2-(3,4,5-trifluorophenyl)ethyl]piperazine-1-carbonyl]phenyl]quinoline-8-sulfonamide.
| Compound Name | N-[4-[(2R)-2-methyl-4-[2-(3,4,5-trifluorophenyl)ethyl]piperazine-1-carbonyl]phenyl]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 70978677 |
| Molecular Formula | C29H27F3N4O3S |
| Molecular Weight | 568.62 g/mol |
| Exact Mass | 568.18 |
| IUPAC Name | N-[4-[(2R)-2-methyl-4-[2-(3,4,5-trifluorophenyl)ethyl]piperazine-1-carbonyl]phenyl]quinoline-8-sulfonamide |
| SMILES | C[C@@H]1CN(CCc2cc(F)c(F)c(F)c2)CCN1C(=O)c1ccc(NS(=O)(=O)c2cccc3cccnc23)cc1 |
| InChI | InChI=1S/C29H27F3N4O3S/c1-19-18-35(13-11-20-16-24(30)27(32)25(31)17-20)14-15-36(19)29(37)22-7-9-23(10-8-22)34-40(38,39)26-6-2-4-21-5-3-12-33-28(21)26/h2-10,12,16-17,19,34H,11,13-15,18H2,1H3/t19-/m1/s1 |
| InChIKey | SLABCCKANWDYQX-LJQANCHMSA-N |
| XLogP | 4.84 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.62 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|