C24H24N4O3S — CID 70978831
4-[3-[1-[[6-(1,3-benzothiazol-6-yl)-2-methylpyrimidin-4-yl]amino]ethyl]phenoxy]butanoic acid (PubChem CID 70978831) has the molecular formula C24H24N4O3S and a molecular weight of 448.55 g/mol. Its IUPAC name is 4-[3-[1-[[6-(1,3-benzothiazol-6-yl)-2-methylpyrimidin-4-yl]amino]ethyl]phenoxy]butanoic acid.
| Compound Name | 4-[3-[1-[[6-(1,3-benzothiazol-6-yl)-2-methylpyrimidin-4-yl]amino]ethyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 70978831 |
| Molecular Formula | C24H24N4O3S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 4-[3-[1-[[6-(1,3-benzothiazol-6-yl)-2-methylpyrimidin-4-yl]amino]ethyl]phenoxy]butanoic acid |
| SMILES | Cc1nc(NC(C)c2cccc(OCCCC(=O)O)c2)cc(-c2ccc3ncsc3c2)n1 |
| InChI | InChI=1S/C24H24N4O3S/c1-15(17-5-3-6-19(11-17)31-10-4-7-24(29)30)26-23-13-21(27-16(2)28-23)18-8-9-20-22(12-18)32-14-25-20/h3,5-6,8-9,11-15H,4,7,10H2,1-2H3,(H,29,30)(H,26,27,28) |
| InChIKey | PYWPTMRWZYRLOA-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 97.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|