C21H19FN2O — CID 70978933
(3R,3aS,6aS)-3-[[5-[2-(3-fluorophenyl)ethynyl]-2-pyridinyl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[b]pyrrol-2-one (PubChem CID 70978933) has the molecular formula C21H19FN2O and a molecular weight of 334.39 g/mol. Its IUPAC name is (3R,3aS,6aS)-3-[[5-[2-(3-fluorophenyl)ethynyl]-2-pyridinyl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[b]pyrrol-2-one.
| Compound Name | (3R,3aS,6aS)-3-[[5-[2-(3-fluorophenyl)ethynyl]-2-pyridinyl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[b]pyrrol-2-one |
|---|---|
| PubChem CID | 70978933 |
| Molecular Formula | C21H19FN2O |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | (3R,3aS,6aS)-3-[[5-[2-(3-fluorophenyl)ethynyl]-2-pyridinyl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[b]pyrrol-2-one |
| SMILES | O=C1N[C@H]2CCC[C@H]2[C@H]1Cc1ccc(C#Cc2cccc(F)c2)cn1 |
| InChI | InChI=1S/C21H19FN2O/c22-16-4-1-3-14(11-16)7-8-15-9-10-17(23-13-15)12-19-18-5-2-6-20(18)24-21(19)25/h1,3-4,9-11,13,18-20H,2,5-6,12H2,(H,24,25)/t18-,19+,20-/m0/s1 |
| InChIKey | FPVRYOSDCFSUPU-ZCNNSNEGSA-N |
| XLogP | 3.08 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|