About 3-[3-[4-(4-chlorophenyl)-5-propyl-1,3-oxazol-2-yl]propoxy]-2,6-difluorobenzamide
3-[3-[4-(4-chlorophenyl)-5-propyl-1,3-oxazol-2-yl]propoxy]-2,6-difluorobenzamide (PubChem CID 70979947) has the molecular formula C22H21ClF2N2O3
and a molecular weight of 434.87 g/mol. Its IUPAC name is 3-[3-[4-(4-chlorophenyl)-5-propyl-1,3-oxazol-2-yl]propoxy]-2,6-difluorobenzamide.
Molecular Properties
| Compound Name | 3-[3-[4-(4-chlorophenyl)-5-propyl-1,3-oxazol-2-yl]propoxy]-2,6-difluorobenzamide |
| PubChem CID | 70979947 |
| Molecular Formula | C22H21ClF2N2O3 |
| Molecular Weight | 434.87 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | 3-[3-[4-(4-chlorophenyl)-5-propyl-1,3-oxazol-2-yl]propoxy]-2,6-difluorobenzamide |
| SMILES | CCCc1oc(CCCOc2ccc(F)c(C(N)=O)c2F)nc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H21ClF2N2O3/c1-2-4-17-21(13-6-8-14(23)9-7-13)27-18(30-17)5-3-12-29-16-11-10-15(24)19(20(16)25)22(26)28/h6-11H,2-5,12H2,1H3,(H2,26,28) |
| InChIKey | XLOUISUGVRWNSD-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.87 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-[4-(4-chlorophenyl)-5-propyl-1,3-oxazol-2-yl]propoxy]-2,6-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-[4-(4-chlorophenyl)-5-propyl-1,3-oxazol-2-yl]propoxy]-2,6-difluorobenzamide?
The IUPAC name of 3-[3-[4-(4-chlorophenyl)-5-propyl-1,3-oxazol-2-yl]propoxy]-2,6-difluorobenzamide (CID 70979947) is 3-[3-[4-(4-chlorophenyl)-5-propyl-1,3-oxazol-2-yl]propoxy]-2,6-difluorobenzamide.
What is the SMILES notation for 3-[3-[4-(4-chlorophenyl)-5-propyl-1,3-oxazol-2-yl]propoxy]-2,6-difluorobenzamide?
The canonical SMILES for 3-[3-[4-(4-chlorophenyl)-5-propyl-1,3-oxazol-2-yl]propoxy]-2,6-difluorobenzamide is CCCc1oc(CCCOc2ccc(F)c(C(N)=O)c2F)nc1-c1ccc(Cl)cc1.
What is the InChIKey of 3-[3-[4-(4-chlorophenyl)-5-propyl-1,3-oxazol-2-yl]propoxy]-2,6-difluorobenzamide?
The InChIKey is XLOUISUGVRWNSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21ClF2N2O3/c1-2-4-17-21(13-6-8-14(23)9-7-13)27-18(30-17)5-3-12-29-16-11-10-15(24)19(20(16)25)22(26)28/h6-11H,2-5,12H2,1H3,(H2,26,28).
What are the key properties of 3-[3-[4-(4-chlorophenyl)-5-propyl-1,3-oxazol-2-yl]propoxy]-2,6-difluorobenzamide?
3-[3-[4-(4-chlorophenyl)-5-propyl-1,3-oxazol-2-yl]propoxy]-2,6-difluorobenzamide has a molecular weight of 434.87 g/mol, XLogP of 5.34, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-[4-(4-chlorophenyl)-5-propyl-1,3-oxazol-2-yl]propoxy]-2,6-difluorobenzamide is sourced from PubChem (CID 70979947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).