C21H19BrF2N2O6 — CID 70980098
3-[2-[5-bromo-4-[4-(2-methoxyethoxy)phenyl]-1,3-oxazol-2-yl]-2-hydroxyethoxy]-2,6-difluorobenzamide (PubChem CID 70980098) has the molecular formula C21H19BrF2N2O6 and a molecular weight of 513.29 g/mol. Its IUPAC name is 3-[2-[5-bromo-4-[4-(2-methoxyethoxy)phenyl]-1,3-oxazol-2-yl]-2-hydroxyethoxy]-2,6-difluorobenzamide.
| Compound Name | 3-[2-[5-bromo-4-[4-(2-methoxyethoxy)phenyl]-1,3-oxazol-2-yl]-2-hydroxyethoxy]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 70980098 |
| Molecular Formula | C21H19BrF2N2O6 |
| Molecular Weight | 513.29 g/mol |
| Exact Mass | 512.04 |
| IUPAC Name | 3-[2-[5-bromo-4-[4-(2-methoxyethoxy)phenyl]-1,3-oxazol-2-yl]-2-hydroxyethoxy]-2,6-difluorobenzamide |
| SMILES | COCCOc1ccc(-c2nc(C(O)COc3ccc(F)c(C(N)=O)c3F)oc2Br)cc1 |
| InChI | InChI=1S/C21H19BrF2N2O6/c1-29-8-9-30-12-4-2-11(3-5-12)18-19(22)32-21(26-18)14(27)10-31-15-7-6-13(23)16(17(15)24)20(25)28/h2-7,14,27H,8-10H2,1H3,(H2,25,28) |
| InChIKey | MFGYCINUMUOTLC-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 117.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.29 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|