About 6-bromo-5-fluoro-3,4-dihydro-1H-quinolin-2-one
6-bromo-5-fluoro-3,4-dihydro-1H-quinolin-2-one (PubChem CID 70980148) has the molecular formula C9H7BrFNO
and a molecular weight of 244.06 g/mol. Its IUPAC name is 6-bromo-5-fluoro-3,4-dihydro-1H-quinolin-2-one.
Molecular Properties
| Compound Name | 6-bromo-5-fluoro-3,4-dihydro-1H-quinolin-2-one |
| PubChem CID | 70980148 |
| Molecular Formula | C9H7BrFNO |
| Molecular Weight | 244.06 g/mol |
| Exact Mass | 242.97 |
| IUPAC Name | 6-bromo-5-fluoro-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2c(ccc(Br)c2F)N1 |
| InChI | InChI=1S/C9H7BrFNO/c10-6-2-3-7-5(9(6)11)1-4-8(13)12-7/h2-3H,1,4H2,(H,12,13) |
| InChIKey | AYPJAYHRTNIPBX-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.06 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-bromo-5-fluoro-3,4-dihydro-1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-5-fluoro-3,4-dihydro-1H-quinolin-2-one?
The IUPAC name of 6-bromo-5-fluoro-3,4-dihydro-1H-quinolin-2-one (CID 70980148) is 6-bromo-5-fluoro-3,4-dihydro-1H-quinolin-2-one.
What is the SMILES notation for 6-bromo-5-fluoro-3,4-dihydro-1H-quinolin-2-one?
The canonical SMILES for 6-bromo-5-fluoro-3,4-dihydro-1H-quinolin-2-one is O=C1CCc2c(ccc(Br)c2F)N1.
What is the InChIKey of 6-bromo-5-fluoro-3,4-dihydro-1H-quinolin-2-one?
The InChIKey is AYPJAYHRTNIPBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7BrFNO/c10-6-2-3-7-5(9(6)11)1-4-8(13)12-7/h2-3H,1,4H2,(H,12,13).
What are the key properties of 6-bromo-5-fluoro-3,4-dihydro-1H-quinolin-2-one?
6-bromo-5-fluoro-3,4-dihydro-1H-quinolin-2-one has a molecular weight of 244.06 g/mol, XLogP of 2.47, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-5-fluoro-3,4-dihydro-1H-quinolin-2-one is sourced from PubChem (CID 70980148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).