About 4-[2-(4-chloro-3,3-dimethyl-2H-indol-1-yl)-2-oxoethyl]-2-methylpiperazine-1-carboxylic acid
4-[2-(4-chloro-3,3-dimethyl-2H-indol-1-yl)-2-oxoethyl]-2-methylpiperazine-1-carboxylic acid (PubChem CID 70980445) has the molecular formula C18H24ClN3O3
and a molecular weight of 365.86 g/mol. Its IUPAC name is 4-[2-(4-chloro-3,3-dimethyl-2H-indol-1-yl)-2-oxoethyl]-2-methylpiperazine-1-carboxylic acid.
Molecular Properties
| Compound Name | 4-[2-(4-chloro-3,3-dimethyl-2H-indol-1-yl)-2-oxoethyl]-2-methylpiperazine-1-carboxylic acid |
| PubChem CID | 70980445 |
| Molecular Formula | C18H24ClN3O3 |
| Molecular Weight | 365.86 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 4-[2-(4-chloro-3,3-dimethyl-2H-indol-1-yl)-2-oxoethyl]-2-methylpiperazine-1-carboxylic acid |
| SMILES | CC1CN(CC(=O)N2CC(C)(C)c3c(Cl)cccc32)CCN1C(=O)O |
| InChI | InChI=1S/C18H24ClN3O3/c1-12-9-20(7-8-21(12)17(24)25)10-15(23)22-11-18(2,3)16-13(19)5-4-6-14(16)22/h4-6,12H,7-11H2,1-3H3,(H,24,25) |
| InChIKey | KHDSYICUWXFHTO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.86 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[2-(4-chloro-3,3-dimethyl-2H-indol-1-yl)-2-oxoethyl]-2-methylpiperazine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(4-chloro-3,3-dimethyl-2H-indol-1-yl)-2-oxoethyl]-2-methylpiperazine-1-carboxylic acid?
The IUPAC name of 4-[2-(4-chloro-3,3-dimethyl-2H-indol-1-yl)-2-oxoethyl]-2-methylpiperazine-1-carboxylic acid (CID 70980445) is 4-[2-(4-chloro-3,3-dimethyl-2H-indol-1-yl)-2-oxoethyl]-2-methylpiperazine-1-carboxylic acid.
What is the SMILES notation for 4-[2-(4-chloro-3,3-dimethyl-2H-indol-1-yl)-2-oxoethyl]-2-methylpiperazine-1-carboxylic acid?
The canonical SMILES for 4-[2-(4-chloro-3,3-dimethyl-2H-indol-1-yl)-2-oxoethyl]-2-methylpiperazine-1-carboxylic acid is CC1CN(CC(=O)N2CC(C)(C)c3c(Cl)cccc32)CCN1C(=O)O.
What is the InChIKey of 4-[2-(4-chloro-3,3-dimethyl-2H-indol-1-yl)-2-oxoethyl]-2-methylpiperazine-1-carboxylic acid?
The InChIKey is KHDSYICUWXFHTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24ClN3O3/c1-12-9-20(7-8-21(12)17(24)25)10-15(23)22-11-18(2,3)16-13(19)5-4-6-14(16)22/h4-6,12H,7-11H2,1-3H3,(H,24,25).
What are the key properties of 4-[2-(4-chloro-3,3-dimethyl-2H-indol-1-yl)-2-oxoethyl]-2-methylpiperazine-1-carboxylic acid?
4-[2-(4-chloro-3,3-dimethyl-2H-indol-1-yl)-2-oxoethyl]-2-methylpiperazine-1-carboxylic acid has a molecular weight of 365.86 g/mol, XLogP of 2.65, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(4-chloro-3,3-dimethyl-2H-indol-1-yl)-2-oxoethyl]-2-methylpiperazine-1-carboxylic acid is sourced from PubChem (CID 70980445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).