About Mesdopetam
Mesdopetam (PubChem CID 70980485) has the molecular formula C12H18FNO3S
and a molecular weight of 275.34 g/mol. Its IUPAC name is N-[2-(3-fluoro-5-methylsulfonylphenoxy)ethyl]propan-1-amine.
Molecular Properties
| Compound Name | Mesdopetam |
| PubChem CID | 70980485 |
| Molecular Formula | C12H18FNO3S |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | N-[2-(3-fluoro-5-methylsulfonylphenoxy)ethyl]propan-1-amine |
| SMILES | CCCNCCOC1=CC(=CC(=C1)S(=O)(=O)C)F |
| InChI | InChI=1S/C12H18FNO3S/c1-3-4-14-5-6-17-11-7-10(13)8-12(9-11)18(2,15)16/h7-9,14H,3-6H2,1-2H3 |
| InChIKey | OSBPYFBXSLJHCR-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 63.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | 329 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze Mesdopetam with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Mesdopetam?
The IUPAC name of Mesdopetam (CID 70980485) is N-[2-(3-fluoro-5-methylsulfonylphenoxy)ethyl]propan-1-amine.
What is the SMILES notation for Mesdopetam?
The canonical SMILES for Mesdopetam is CCCNCCOC1=CC(=CC(=C1)S(=O)(=O)C)F.
What is the InChIKey of Mesdopetam?
The InChIKey is OSBPYFBXSLJHCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18FNO3S/c1-3-4-14-5-6-17-11-7-10(13)8-12(9-11)18(2,15)16/h7-9,14H,3-6H2,1-2H3.
What are the key properties of Mesdopetam?
Mesdopetam has a molecular weight of 275.34 g/mol, XLogP of 1.70, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for Mesdopetam is sourced from PubChem (CID 70980485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).