C13H18F3N3O5 — CID 70980590
N-(2-aminoethyl)-4-(2,5-dioxopyrrol-1-yl)-N-methylbutanamide;2,2,2-trifluoroacetic acid (PubChem CID 70980590) has the molecular formula C13H18F3N3O5 and a molecular weight of 353.30 g/mol. Its IUPAC name is N-(2-aminoethyl)-4-(2,5-dioxopyrrol-1-yl)-N-methylbutanamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-(2-aminoethyl)-4-(2,5-dioxopyrrol-1-yl)-N-methylbutanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 70980590 |
| Molecular Formula | C13H18F3N3O5 |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | N-(2-aminoethyl)-4-(2,5-dioxopyrrol-1-yl)-N-methylbutanamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(CCN)C(=O)CCCN1C(=O)C=CC1=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C11H17N3O3.C2HF3O2/c1-13(8-6-12)9(15)3-2-7-14-10(16)4-5-11(14)17;3-2(4,5)1(6)7/h4-5H,2-3,6-8,12H2,1H3;(H,6,7) |
| InChIKey | JJIFCNHWCDUSER-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 121.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|