C22H25FN8O — CID 70981024
[2-[6-(dimethylamino)-2-methylpyrimidin-4-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[4-fluoro-2-(triazol-2-yl)phenyl]methanone (PubChem CID 70981024) has the molecular formula C22H25FN8O and a molecular weight of 436.50 g/mol. Its IUPAC name is [2-[6-(dimethylamino)-2-methylpyrimidin-4-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[4-fluoro-2-(triazol-2-yl)phenyl]methanone.
| Compound Name | [2-[6-(dimethylamino)-2-methylpyrimidin-4-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[4-fluoro-2-(triazol-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 70981024 |
| Molecular Formula | C22H25FN8O |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | [2-[6-(dimethylamino)-2-methylpyrimidin-4-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[4-fluoro-2-(triazol-2-yl)phenyl]methanone |
| SMILES | Cc1nc(N(C)C)cc(N2CC3CN(C(=O)c4ccc(F)cc4-n4nccn4)CC3C2)n1 |
| InChI | InChI=1S/C22H25FN8O/c1-14-26-20(28(2)3)9-21(27-14)29-10-15-12-30(13-16(15)11-29)22(32)18-5-4-17(23)8-19(18)31-24-6-7-25-31/h4-9,15-16H,10-13H2,1-3H3 |
| InChIKey | POOUPVRKNHOAHY-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 83.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |