C14H20F3N3O5 — CID 70981143
4-(2,5-dioxopyrrol-1-yl)-N-methyl-N-[2-(methylamino)ethyl]butanamide;2,2,2-trifluoroacetic acid (PubChem CID 70981143) has the molecular formula C14H20F3N3O5 and a molecular weight of 367.32 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrol-1-yl)-N-methyl-N-[2-(methylamino)ethyl]butanamide;2,2,2-trifluoroacetic acid.
| Compound Name | 4-(2,5-dioxopyrrol-1-yl)-N-methyl-N-[2-(methylamino)ethyl]butanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 70981143 |
| Molecular Formula | C14H20F3N3O5 |
| Molecular Weight | 367.32 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 4-(2,5-dioxopyrrol-1-yl)-N-methyl-N-[2-(methylamino)ethyl]butanamide;2,2,2-trifluoroacetic acid |
| SMILES | CNCCN(C)C(=O)CCCN1C(=O)C=CC1=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H19N3O3.C2HF3O2/c1-13-7-9-14(2)10(16)4-3-8-15-11(17)5-6-12(15)18;3-2(4,5)1(6)7/h5-6,13H,3-4,7-9H2,1-2H3;(H,6,7) |
| InChIKey | BCLQXKHXBZNLCZ-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.32 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|