About 6,6a-dihydrobenzo[c][1,2]benzothiazepine 5,5-dioxide
6,6a-dihydrobenzo[c][1,2]benzothiazepine 5,5-dioxide (PubChem CID 70981162) has the molecular formula C13H11NO2S
and a molecular weight of 245.30 g/mol. Its IUPAC name is 6,6a-dihydrobenzo[c][1,2]benzothiazepine 5,5-dioxide.
Molecular Properties
| Compound Name | 6,6a-dihydrobenzo[c][1,2]benzothiazepine 5,5-dioxide |
| PubChem CID | 70981162 |
| Molecular Formula | C13H11NO2S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 6,6a-dihydrobenzo[c][1,2]benzothiazepine 5,5-dioxide |
| SMILES | O=S1(=O)NC2C=CC=CC2=Cc2ccccc21 |
| InChI | InChI=1S/C13H11NO2S/c15-17(16)13-8-4-2-6-11(13)9-10-5-1-3-7-12(10)14-17/h1-9,12,14H |
| InChIKey | DMWRHPIUTZBELE-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,6a-dihydrobenzo[c][1,2]benzothiazepine 5,5-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6a-dihydrobenzo[c][1,2]benzothiazepine 5,5-dioxide?
The IUPAC name of 6,6a-dihydrobenzo[c][1,2]benzothiazepine 5,5-dioxide (CID 70981162) is 6,6a-dihydrobenzo[c][1,2]benzothiazepine 5,5-dioxide.
What is the SMILES notation for 6,6a-dihydrobenzo[c][1,2]benzothiazepine 5,5-dioxide?
The canonical SMILES for 6,6a-dihydrobenzo[c][1,2]benzothiazepine 5,5-dioxide is O=S1(=O)NC2C=CC=CC2=Cc2ccccc21.
What is the InChIKey of 6,6a-dihydrobenzo[c][1,2]benzothiazepine 5,5-dioxide?
The InChIKey is DMWRHPIUTZBELE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO2S/c15-17(16)13-8-4-2-6-11(13)9-10-5-1-3-7-12(10)14-17/h1-9,12,14H.
What are the key properties of 6,6a-dihydrobenzo[c][1,2]benzothiazepine 5,5-dioxide?
6,6a-dihydrobenzo[c][1,2]benzothiazepine 5,5-dioxide has a molecular weight of 245.30 g/mol, XLogP of 1.86, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6a-dihydrobenzo[c][1,2]benzothiazepine 5,5-dioxide is sourced from PubChem (CID 70981162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).