C8H14N6O — CID 70981182
2-(2-aminoethylamino)-4-(methylamino)pyrimidine-5-carboxamide (PubChem CID 70981182) has the molecular formula C8H14N6O and a molecular weight of 210.24 g/mol. Its IUPAC name is 2-(2-aminoethylamino)-4-(methylamino)pyrimidine-5-carboxamide.
| Compound Name | 2-(2-aminoethylamino)-4-(methylamino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 70981182 |
| Molecular Formula | C8H14N6O |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 2-(2-aminoethylamino)-4-(methylamino)pyrimidine-5-carboxamide |
| SMILES | CNc1nc(NCCN)ncc1C(N)=O |
| InChI | InChI=1S/C8H14N6O/c1-11-7-5(6(10)15)4-13-8(14-7)12-3-2-9/h4H,2-3,9H2,1H3,(H2,10,15)(H2,11,12,13,14) |
| InChIKey | ALYYEJSTMRTGLB-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |