About 7-(4-chlorophenyl)-5-methyl-2-(2-methylpropyl)-1,3-benzothiazol-6-ol
7-(4-chlorophenyl)-5-methyl-2-(2-methylpropyl)-1,3-benzothiazol-6-ol (PubChem CID 70981229) has the molecular formula C18H18ClNOS
and a molecular weight of 331.87 g/mol. Its IUPAC name is 7-(4-chlorophenyl)-5-methyl-2-(2-methylpropyl)-1,3-benzothiazol-6-ol.
Molecular Properties
| Compound Name | 7-(4-chlorophenyl)-5-methyl-2-(2-methylpropyl)-1,3-benzothiazol-6-ol |
| PubChem CID | 70981229 |
| Molecular Formula | C18H18ClNOS |
| Molecular Weight | 331.87 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 7-(4-chlorophenyl)-5-methyl-2-(2-methylpropyl)-1,3-benzothiazol-6-ol |
| SMILES | Cc1cc2nc(CC(C)C)sc2c(-c2ccc(Cl)cc2)c1O |
| InChI | InChI=1S/C18H18ClNOS/c1-10(2)8-15-20-14-9-11(3)17(21)16(18(14)22-15)12-4-6-13(19)7-5-12/h4-7,9-10,21H,8H2,1-3H3 |
| InChIKey | RMZMYSVNLAAHDI-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 331.87 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-(4-chlorophenyl)-5-methyl-2-(2-methylpropyl)-1,3-benzothiazol-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(4-chlorophenyl)-5-methyl-2-(2-methylpropyl)-1,3-benzothiazol-6-ol?
The IUPAC name of 7-(4-chlorophenyl)-5-methyl-2-(2-methylpropyl)-1,3-benzothiazol-6-ol (CID 70981229) is 7-(4-chlorophenyl)-5-methyl-2-(2-methylpropyl)-1,3-benzothiazol-6-ol.
What is the SMILES notation for 7-(4-chlorophenyl)-5-methyl-2-(2-methylpropyl)-1,3-benzothiazol-6-ol?
The canonical SMILES for 7-(4-chlorophenyl)-5-methyl-2-(2-methylpropyl)-1,3-benzothiazol-6-ol is Cc1cc2nc(CC(C)C)sc2c(-c2ccc(Cl)cc2)c1O.
What is the InChIKey of 7-(4-chlorophenyl)-5-methyl-2-(2-methylpropyl)-1,3-benzothiazol-6-ol?
The InChIKey is RMZMYSVNLAAHDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18ClNOS/c1-10(2)8-15-20-14-9-11(3)17(21)16(18(14)22-15)12-4-6-13(19)7-5-12/h4-7,9-10,21H,8H2,1-3H3.
What are the key properties of 7-(4-chlorophenyl)-5-methyl-2-(2-methylpropyl)-1,3-benzothiazol-6-ol?
7-(4-chlorophenyl)-5-methyl-2-(2-methylpropyl)-1,3-benzothiazol-6-ol has a molecular weight of 331.87 g/mol, XLogP of 5.83, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(4-chlorophenyl)-5-methyl-2-(2-methylpropyl)-1,3-benzothiazol-6-ol is sourced from PubChem (CID 70981229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).