C21H19F2N5O2 — CID 70981286
[2-(5-fluoro-4-methylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[3-fluoro-2-(1,3-oxazol-2-yl)phenyl]methanone (PubChem CID 70981286) has the molecular formula C21H19F2N5O2 and a molecular weight of 411.41 g/mol. Its IUPAC name is [2-(5-fluoro-4-methylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[3-fluoro-2-(1,3-oxazol-2-yl)phenyl]methanone.
| Compound Name | [2-(5-fluoro-4-methylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[3-fluoro-2-(1,3-oxazol-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 70981286 |
| Molecular Formula | C21H19F2N5O2 |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | [2-(5-fluoro-4-methylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[3-fluoro-2-(1,3-oxazol-2-yl)phenyl]methanone |
| SMILES | Cc1nc(N2CC3CN(C(=O)c4cccc(F)c4-c4ncco4)CC3C2)ncc1F |
| InChI | InChI=1S/C21H19F2N5O2/c1-12-17(23)7-25-21(26-12)28-10-13-8-27(9-14(13)11-28)20(29)15-3-2-4-16(22)18(15)19-24-5-6-30-19/h2-7,13-14H,8-11H2,1H3 |
| InChIKey | AMJDRODUMFEYGO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 75.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |