About benzenesulfonylbenzene
benzenesulfonylbenzene (PubChem CID 70981865) has the molecular formula C24H20O4S2
and a molecular weight of 436.55 g/mol. Its IUPAC name is benzenesulfonylbenzene.
Molecular Properties
| Compound Name | benzenesulfonylbenzene |
| PubChem CID | 70981865 |
| Molecular Formula | C24H20O4S2 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | benzenesulfonylbenzene |
| SMILES | O=S(=O)(c1ccccc1)c1ccccc1.O=S(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/2C12H10O2S/c2*13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h2*1-10H |
| InChIKey | OWRHOGANNJOKHG-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze benzenesulfonylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenesulfonylbenzene?
The IUPAC name of benzenesulfonylbenzene (CID 70981865) is benzenesulfonylbenzene.
What is the SMILES notation for benzenesulfonylbenzene?
The canonical SMILES for benzenesulfonylbenzene is O=S(=O)(c1ccccc1)c1ccccc1.O=S(=O)(c1ccccc1)c1ccccc1.
What is the InChIKey of benzenesulfonylbenzene?
The InChIKey is OWRHOGANNJOKHG-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H10O2S/c2*13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h2*1-10H.
What are the key properties of benzenesulfonylbenzene?
benzenesulfonylbenzene has a molecular weight of 436.55 g/mol, XLogP of 5.04, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzenesulfonylbenzene is sourced from PubChem (CID 70981865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).