C24H18F3N5O2 — CID 70982026
[2-(6,7-difluoroquinoxalin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[3-fluoro-2-(1,3-oxazol-2-yl)phenyl]methanone (PubChem CID 70982026) has the molecular formula C24H18F3N5O2 and a molecular weight of 465.44 g/mol. Its IUPAC name is [2-(6,7-difluoroquinoxalin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[3-fluoro-2-(1,3-oxazol-2-yl)phenyl]methanone.
| Compound Name | [2-(6,7-difluoroquinoxalin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[3-fluoro-2-(1,3-oxazol-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 70982026 |
| Molecular Formula | C24H18F3N5O2 |
| Molecular Weight | 465.44 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | [2-(6,7-difluoroquinoxalin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[3-fluoro-2-(1,3-oxazol-2-yl)phenyl]methanone |
| SMILES | O=C(c1cccc(F)c1-c1ncco1)N1CC2CN(c3cnc4cc(F)c(F)cc4n3)CC2C1 |
| InChI | InChI=1S/C24H18F3N5O2/c25-16-3-1-2-15(22(16)23-28-4-5-34-23)24(33)32-11-13-9-31(10-14(13)12-32)21-8-29-19-6-17(26)18(27)7-20(19)30-21/h1-8,13-14H,9-12H2 |
| InChIKey | SUMVDFHSJADIHY-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 75.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |