About 2-(2-chlorophenyl)-N-(4-piperazin-1-yl-3-pyridinyl)imidazo[1,5-b]pyridazin-7-amine
2-(2-chlorophenyl)-N-(4-piperazin-1-yl-3-pyridinyl)imidazo[1,5-b]pyridazin-7-amine (PubChem CID 70982172) has the molecular formula C21H20ClN7
and a molecular weight of 405.89 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-(4-piperazin-1-yl-3-pyridinyl)imidazo[1,5-b]pyridazin-7-amine.
Molecular Properties
| Compound Name | 2-(2-chlorophenyl)-N-(4-piperazin-1-yl-3-pyridinyl)imidazo[1,5-b]pyridazin-7-amine |
| PubChem CID | 70982172 |
| Molecular Formula | C21H20ClN7 |
| Molecular Weight | 405.89 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 2-(2-chlorophenyl)-N-(4-piperazin-1-yl-3-pyridinyl)imidazo[1,5-b]pyridazin-7-amine |
| SMILES | Clc1ccccc1-c1ccc2cnc(Nc3cnccc3N3CCNCC3)n2n1 |
| InChI | InChI=1S/C21H20ClN7/c22-17-4-2-1-3-16(17)18-6-5-15-13-25-21(29(15)27-18)26-19-14-24-8-7-20(19)28-11-9-23-10-12-28/h1-8,13-14,23H,9-12H2,(H,25,26) |
| InChIKey | WDENWXDMHCFKSS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 70.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.89 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(2-chlorophenyl)-N-(4-piperazin-1-yl-3-pyridinyl)imidazo[1,5-b]pyridazin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-chlorophenyl)-N-(4-piperazin-1-yl-3-pyridinyl)imidazo[1,5-b]pyridazin-7-amine?
The IUPAC name of 2-(2-chlorophenyl)-N-(4-piperazin-1-yl-3-pyridinyl)imidazo[1,5-b]pyridazin-7-amine (CID 70982172) is 2-(2-chlorophenyl)-N-(4-piperazin-1-yl-3-pyridinyl)imidazo[1,5-b]pyridazin-7-amine.
What is the SMILES notation for 2-(2-chlorophenyl)-N-(4-piperazin-1-yl-3-pyridinyl)imidazo[1,5-b]pyridazin-7-amine?
The canonical SMILES for 2-(2-chlorophenyl)-N-(4-piperazin-1-yl-3-pyridinyl)imidazo[1,5-b]pyridazin-7-amine is Clc1ccccc1-c1ccc2cnc(Nc3cnccc3N3CCNCC3)n2n1.
What is the InChIKey of 2-(2-chlorophenyl)-N-(4-piperazin-1-yl-3-pyridinyl)imidazo[1,5-b]pyridazin-7-amine?
The InChIKey is WDENWXDMHCFKSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20ClN7/c22-17-4-2-1-3-16(17)18-6-5-15-13-25-21(29(15)27-18)26-19-14-24-8-7-20(19)28-11-9-23-10-12-28/h1-8,13-14,23H,9-12H2,(H,25,26).
What are the key properties of 2-(2-chlorophenyl)-N-(4-piperazin-1-yl-3-pyridinyl)imidazo[1,5-b]pyridazin-7-amine?
2-(2-chlorophenyl)-N-(4-piperazin-1-yl-3-pyridinyl)imidazo[1,5-b]pyridazin-7-amine has a molecular weight of 405.89 g/mol, XLogP of 3.60, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-chlorophenyl)-N-(4-piperazin-1-yl-3-pyridinyl)imidazo[1,5-b]pyridazin-7-amine is sourced from PubChem (CID 70982172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).