C20H27N5O2S — CID 7098268
N-[(1S)-2-(tert-butylamino)-1-[4-(dimethylamino)phenyl]-2-oxoethyl]-N-cyclopropylthiadiazole-4-carboxamide (PubChem CID 7098268) has the molecular formula C20H27N5O2S and a molecular weight of 401.54 g/mol. Its IUPAC name is N-[(1S)-2-(tert-butylamino)-1-[4-(dimethylamino)phenyl]-2-oxoethyl]-N-cyclopropylthiadiazole-4-carboxamide.
| Compound Name | N-[(1S)-2-(tert-butylamino)-1-[4-(dimethylamino)phenyl]-2-oxoethyl]-N-cyclopropylthiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 7098268 |
| Molecular Formula | C20H27N5O2S |
| Molecular Weight | 401.54 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | N-[(1S)-2-(tert-butylamino)-1-[4-(dimethylamino)phenyl]-2-oxoethyl]-N-cyclopropylthiadiazole-4-carboxamide |
| SMILES | CN(C)c1ccc([C@@H](C(=O)NC(C)(C)C)N(C(=O)c2csnn2)C2CC2)cc1 |
| InChI | InChI=1S/C20H27N5O2S/c1-20(2,3)21-18(26)17(13-6-8-14(9-7-13)24(4)5)25(15-10-11-15)19(27)16-12-28-23-22-16/h6-9,12,15,17H,10-11H2,1-5H3,(H,21,26)/t17-/m0/s1 |
| InChIKey | QENMMKTVMQNPRT-KRWDZBQOSA-N |
| XLogP | 2.86 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.54 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|