C18H26N2O5 — CID 70982900
tert-butyl 3-methoxy-4-(phenylmethoxycarbonylamino)pyrrolidine-1-carboxylate (PubChem CID 70982900) has the molecular formula C18H26N2O5 and a molecular weight of 350.42 g/mol. Its IUPAC name is tert-butyl 3-methoxy-4-(phenylmethoxycarbonylamino)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-methoxy-4-(phenylmethoxycarbonylamino)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 70982900 |
| Molecular Formula | C18H26N2O5 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | tert-butyl 3-methoxy-4-(phenylmethoxycarbonylamino)pyrrolidine-1-carboxylate |
| SMILES | COC1CN(C(=O)OC(C)(C)C)CC1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H26N2O5/c1-18(2,3)25-17(22)20-10-14(15(11-20)23-4)19-16(21)24-12-13-8-6-5-7-9-13/h5-9,14-15H,10-12H2,1-4H3,(H,19,21) |
| InChIKey | CSTKCOZZJVFEMP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |