About methyl-[2-methyl-6-(2,2,2-trifluoroethoxy)-4-pyridinyl]carbamic acid
methyl-[2-methyl-6-(2,2,2-trifluoroethoxy)-4-pyridinyl]carbamic acid (PubChem CID 70982934) has the molecular formula C10H11F3N2O3
and a molecular weight of 264.20 g/mol. Its IUPAC name is methyl-[2-methyl-6-(2,2,2-trifluoroethoxy)-4-pyridinyl]carbamic acid.
Molecular Properties
| Compound Name | methyl-[2-methyl-6-(2,2,2-trifluoroethoxy)-4-pyridinyl]carbamic acid |
| PubChem CID | 70982934 |
| Molecular Formula | C10H11F3N2O3 |
| Molecular Weight | 264.20 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | methyl-[2-methyl-6-(2,2,2-trifluoroethoxy)-4-pyridinyl]carbamic acid |
| SMILES | Cc1cc(N(C)C(=O)O)cc(OCC(F)(F)F)n1 |
| InChI | InChI=1S/C10H11F3N2O3/c1-6-3-7(15(2)9(16)17)4-8(14-6)18-5-10(11,12)13/h3-4H,5H2,1-2H3,(H,16,17) |
| InChIKey | OHNJOHSDBYGTSE-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.20 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl-[2-methyl-6-(2,2,2-trifluoroethoxy)-4-pyridinyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-[2-methyl-6-(2,2,2-trifluoroethoxy)-4-pyridinyl]carbamic acid?
The IUPAC name of methyl-[2-methyl-6-(2,2,2-trifluoroethoxy)-4-pyridinyl]carbamic acid (CID 70982934) is methyl-[2-methyl-6-(2,2,2-trifluoroethoxy)-4-pyridinyl]carbamic acid.
What is the SMILES notation for methyl-[2-methyl-6-(2,2,2-trifluoroethoxy)-4-pyridinyl]carbamic acid?
The canonical SMILES for methyl-[2-methyl-6-(2,2,2-trifluoroethoxy)-4-pyridinyl]carbamic acid is Cc1cc(N(C)C(=O)O)cc(OCC(F)(F)F)n1.
What is the InChIKey of methyl-[2-methyl-6-(2,2,2-trifluoroethoxy)-4-pyridinyl]carbamic acid?
The InChIKey is OHNJOHSDBYGTSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F3N2O3/c1-6-3-7(15(2)9(16)17)4-8(14-6)18-5-10(11,12)13/h3-4H,5H2,1-2H3,(H,16,17).
What are the key properties of methyl-[2-methyl-6-(2,2,2-trifluoroethoxy)-4-pyridinyl]carbamic acid?
methyl-[2-methyl-6-(2,2,2-trifluoroethoxy)-4-pyridinyl]carbamic acid has a molecular weight of 264.20 g/mol, XLogP of 2.45, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-[2-methyl-6-(2,2,2-trifluoroethoxy)-4-pyridinyl]carbamic acid is sourced from PubChem (CID 70982934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).