C14H7ClF3IN2 — CID 70983333
6-chloro-1-iodo-3-[(2,3,6-trifluorophenyl)methyl]imidazo[1,5-a]pyridine (PubChem CID 70983333) has the molecular formula C14H7ClF3IN2 and a molecular weight of 422.58 g/mol. Its IUPAC name is 6-chloro-1-iodo-3-[(2,3,6-trifluorophenyl)methyl]imidazo[1,5-a]pyridine.
| Compound Name | 6-chloro-1-iodo-3-[(2,3,6-trifluorophenyl)methyl]imidazo[1,5-a]pyridine |
|---|---|
| PubChem CID | 70983333 |
| Molecular Formula | C14H7ClF3IN2 |
| Molecular Weight | 422.58 g/mol |
| Exact Mass | 421.93 |
| IUPAC Name | 6-chloro-1-iodo-3-[(2,3,6-trifluorophenyl)methyl]imidazo[1,5-a]pyridine |
| SMILES | Fc1ccc(F)c(Cc2nc(I)c3ccc(Cl)cn23)c1F |
| InChI | InChI=1S/C14H7ClF3IN2/c15-7-1-4-11-14(19)20-12(21(11)6-7)5-8-9(16)2-3-10(17)13(8)18/h1-4,6H,5H2 |
| InChIKey | GBOUXQKMOPLPFB-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.58 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|