C25H28N4O4 — CID 70983730
N-[4-[1-(1,3-benzodioxole-5-carbonyl)piperidin-4-yl]butyl]imidazo[1,2-a]pyridine-6-carboxamide (PubChem CID 70983730) has the molecular formula C25H28N4O4 and a molecular weight of 448.52 g/mol. Its IUPAC name is N-[4-[1-(1,3-benzodioxole-5-carbonyl)piperidin-4-yl]butyl]imidazo[1,2-a]pyridine-6-carboxamide.
| Compound Name | N-[4-[1-(1,3-benzodioxole-5-carbonyl)piperidin-4-yl]butyl]imidazo[1,2-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 70983730 |
| Molecular Formula | C25H28N4O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | N-[4-[1-(1,3-benzodioxole-5-carbonyl)piperidin-4-yl]butyl]imidazo[1,2-a]pyridine-6-carboxamide |
| SMILES | O=C(NCCCCC1CCN(C(=O)c2ccc3c(c2)OCO3)CC1)c1ccc2nccn2c1 |
| InChI | InChI=1S/C25H28N4O4/c30-24(20-5-7-23-26-11-14-29(23)16-20)27-10-2-1-3-18-8-12-28(13-9-18)25(31)19-4-6-21-22(15-19)33-17-32-21/h4-7,11,14-16,18H,1-3,8-10,12-13,17H2,(H,27,30) |
| InChIKey | NOQZQRGUGNELCR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|