C35H38N4O5 — CID 70983836
3-[[3-[[4-[1-[4-(2,3-dimethylphenoxy)butanoyl]-3,4-dihydro-2H-quinolin-5-yl]pyrazol-1-yl]methyl]phenyl]methylamino]-3-oxopropanoic acid (PubChem CID 70983836) has the molecular formula C35H38N4O5 and a molecular weight of 594.71 g/mol. Its IUPAC name is 3-[[3-[[4-[1-[4-(2,3-dimethylphenoxy)butanoyl]-3,4-dihydro-2H-quinolin-5-yl]pyrazol-1-yl]methyl]phenyl]methylamino]-3-oxopropanoic acid.
| Compound Name | 3-[[3-[[4-[1-[4-(2,3-dimethylphenoxy)butanoyl]-3,4-dihydro-2H-quinolin-5-yl]pyrazol-1-yl]methyl]phenyl]methylamino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 70983836 |
| Molecular Formula | C35H38N4O5 |
| Molecular Weight | 594.71 g/mol |
| Exact Mass | 594.28 |
| IUPAC Name | 3-[[3-[[4-[1-[4-(2,3-dimethylphenoxy)butanoyl]-3,4-dihydro-2H-quinolin-5-yl]pyrazol-1-yl]methyl]phenyl]methylamino]-3-oxopropanoic acid |
| SMILES | Cc1cccc(OCCCC(=O)N2CCCc3c(-c4cnn(Cc5cccc(CNC(=O)CC(=O)O)c5)c4)cccc32)c1C |
| InChI | InChI=1S/C35H38N4O5/c1-24-8-3-14-32(25(24)2)44-17-7-15-34(41)39-16-6-12-30-29(11-5-13-31(30)39)28-21-37-38(23-28)22-27-10-4-9-26(18-27)20-36-33(40)19-35(42)43/h3-5,8-11,13-14,18,21,23H,6-7,12,15-17,19-20,22H2,1-2H3,(H,36,40)(H,42,43) |
| InChIKey | YOBFWLQJWCNCGY-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.71 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|