About 3-ethoxy-2-pyridin-2-ylpent-2-enenitrile;1H-pyrazol-5-amine
3-ethoxy-2-pyridin-2-ylpent-2-enenitrile;1H-pyrazol-5-amine (PubChem CID 70984073) has the molecular formula C15H19N5O
and a molecular weight of 285.35 g/mol. Its IUPAC name is 3-ethoxy-2-pyridin-2-ylpent-2-enenitrile;1H-pyrazol-5-amine.
Molecular Properties
| Compound Name | 3-ethoxy-2-pyridin-2-ylpent-2-enenitrile;1H-pyrazol-5-amine |
| PubChem CID | 70984073 |
| Molecular Formula | C15H19N5O |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 3-ethoxy-2-pyridin-2-ylpent-2-enenitrile;1H-pyrazol-5-amine |
| SMILES | CCOC(CC)=C(C#N)c1ccccn1.Nc1ccn[nH]1 |
| InChI | InChI=1S/C12H14N2O.C3H5N3/c1-3-12(15-4-2)10(9-13)11-7-5-6-8-14-11;4-3-1-2-5-6-3/h5-8H,3-4H2,1-2H3;1-2H,(H3,4,5,6) |
| InChIKey | PKFOOZSKWHMSHR-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 100.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 3-ethoxy-2-pyridin-2-ylpent-2-enenitrile;1H-pyrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-2-pyridin-2-ylpent-2-enenitrile;1H-pyrazol-5-amine?
The IUPAC name of 3-ethoxy-2-pyridin-2-ylpent-2-enenitrile;1H-pyrazol-5-amine (CID 70984073) is 3-ethoxy-2-pyridin-2-ylpent-2-enenitrile;1H-pyrazol-5-amine.
What is the SMILES notation for 3-ethoxy-2-pyridin-2-ylpent-2-enenitrile;1H-pyrazol-5-amine?
The canonical SMILES for 3-ethoxy-2-pyridin-2-ylpent-2-enenitrile;1H-pyrazol-5-amine is CCOC(CC)=C(C#N)c1ccccn1.Nc1ccn[nH]1.
What is the InChIKey of 3-ethoxy-2-pyridin-2-ylpent-2-enenitrile;1H-pyrazol-5-amine?
The InChIKey is PKFOOZSKWHMSHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O.C3H5N3/c1-3-12(15-4-2)10(9-13)11-7-5-6-8-14-11;4-3-1-2-5-6-3/h5-8H,3-4H2,1-2H3;1-2H,(H3,4,5,6).
What are the key properties of 3-ethoxy-2-pyridin-2-ylpent-2-enenitrile;1H-pyrazol-5-amine?
3-ethoxy-2-pyridin-2-ylpent-2-enenitrile;1H-pyrazol-5-amine has a molecular weight of 285.35 g/mol, XLogP of 2.75, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-2-pyridin-2-ylpent-2-enenitrile;1H-pyrazol-5-amine is sourced from PubChem (CID 70984073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).