C23H22F4N6O3 — CID 70984154
[1-[(1R)-2,2,2-trifluoro-1-[6-[2-[(6-fluoro-7-methoxyquinolin-2-yl)methylidene]hydrazinyl]-3-pyridinyl]ethyl]pyrrolidin-3-yl]carbamic acid (PubChem CID 70984154) has the molecular formula C23H22F4N6O3 and a molecular weight of 506.46 g/mol. Its IUPAC name is [1-[(1R)-2,2,2-trifluoro-1-[6-[2-[(6-fluoro-7-methoxyquinolin-2-yl)methylidene]hydrazinyl]-3-pyridinyl]ethyl]pyrrolidin-3-yl]carbamic acid.
| Compound Name | [1-[(1R)-2,2,2-trifluoro-1-[6-[2-[(6-fluoro-7-methoxyquinolin-2-yl)methylidene]hydrazinyl]-3-pyridinyl]ethyl]pyrrolidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 70984154 |
| Molecular Formula | C23H22F4N6O3 |
| Molecular Weight | 506.46 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | [1-[(1R)-2,2,2-trifluoro-1-[6-[2-[(6-fluoro-7-methoxyquinolin-2-yl)methylidene]hydrazinyl]-3-pyridinyl]ethyl]pyrrolidin-3-yl]carbamic acid |
| SMILES | COc1cc2nc(C=NNc3ccc([C@@H](N4CCC(NC(=O)O)C4)C(F)(F)F)cn3)ccc2cc1F |
| InChI | InChI=1S/C23H22F4N6O3/c1-36-19-9-18-13(8-17(19)24)2-4-15(30-18)11-29-32-20-5-3-14(10-28-20)21(23(25,26)27)33-7-6-16(12-33)31-22(34)35/h2-5,8-11,16,21,31H,6-7,12H2,1H3,(H,28,32)(H,34,35)/t16?,21-/m1/s1 |
| InChIKey | VVACMALDAXTQKM-CAWMZFRYSA-N |
| XLogP | 4.17 |
| TPSA | 111.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.46 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|