About spiro[4.6]undecane-2,3-dicarbonitrile
spiro[4.6]undecane-2,3-dicarbonitrile (PubChem CID 70984843) has the molecular formula C13H18N2
and a molecular weight of 202.30 g/mol. Its IUPAC name is spiro[4.6]undecane-2,3-dicarbonitrile.
Molecular Properties
| Compound Name | spiro[4.6]undecane-2,3-dicarbonitrile |
| PubChem CID | 70984843 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | spiro[4.6]undecane-2,3-dicarbonitrile |
| SMILES | N#CC1CC2(CCCCCC2)CC1C#N |
| InChI | InChI=1S/C13H18N2/c14-9-11-7-13(8-12(11)10-15)5-3-1-2-4-6-13/h11-12H,1-8H2 |
| InChIKey | BFHSYKCYQQBXTO-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze spiro[4.6]undecane-2,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[4.6]undecane-2,3-dicarbonitrile?
The IUPAC name of spiro[4.6]undecane-2,3-dicarbonitrile (CID 70984843) is spiro[4.6]undecane-2,3-dicarbonitrile.
What is the SMILES notation for spiro[4.6]undecane-2,3-dicarbonitrile?
The canonical SMILES for spiro[4.6]undecane-2,3-dicarbonitrile is N#CC1CC2(CCCCCC2)CC1C#N.
What is the InChIKey of spiro[4.6]undecane-2,3-dicarbonitrile?
The InChIKey is BFHSYKCYQQBXTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2/c14-9-11-7-13(8-12(11)10-15)5-3-1-2-4-6-13/h11-12H,1-8H2.
What are the key properties of spiro[4.6]undecane-2,3-dicarbonitrile?
spiro[4.6]undecane-2,3-dicarbonitrile has a molecular weight of 202.30 g/mol, XLogP of 3.40, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[4.6]undecane-2,3-dicarbonitrile is sourced from PubChem (CID 70984843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).