C26H25ClN2O4 — CID 70984942
2-[3-chloro-4-[4-[(4-phenylpiperidine-1-carbonyl)amino]phenoxy]phenyl]acetic acid (PubChem CID 70984942) has the molecular formula C26H25ClN2O4 and a molecular weight of 464.95 g/mol. Its IUPAC name is 2-[3-chloro-4-[4-[(4-phenylpiperidine-1-carbonyl)amino]phenoxy]phenyl]acetic acid.
| Compound Name | 2-[3-chloro-4-[4-[(4-phenylpiperidine-1-carbonyl)amino]phenoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 70984942 |
| Molecular Formula | C26H25ClN2O4 |
| Molecular Weight | 464.95 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | 2-[3-chloro-4-[4-[(4-phenylpiperidine-1-carbonyl)amino]phenoxy]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(Oc2ccc(NC(=O)N3CCC(c4ccccc4)CC3)cc2)c(Cl)c1 |
| InChI | InChI=1S/C26H25ClN2O4/c27-23-16-18(17-25(30)31)6-11-24(23)33-22-9-7-21(8-10-22)28-26(32)29-14-12-20(13-15-29)19-4-2-1-3-5-19/h1-11,16,20H,12-15,17H2,(H,28,32)(H,30,31) |
| InChIKey | YOWQJZWMVIVSLU-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.95 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |