C24H30N2O4S — CID 70985363
5-(4-methylpiperidin-1-yl)sulfonyl-N-(3-phenylpropyl)-2,3-dihydro-1-benzofuran-2-carboxamide (PubChem CID 70985363) has the molecular formula C24H30N2O4S and a molecular weight of 442.58 g/mol. Its IUPAC name is 5-(4-methylpiperidin-1-yl)sulfonyl-N-(3-phenylpropyl)-2,3-dihydro-1-benzofuran-2-carboxamide.
| Compound Name | 5-(4-methylpiperidin-1-yl)sulfonyl-N-(3-phenylpropyl)-2,3-dihydro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 70985363 |
| Molecular Formula | C24H30N2O4S |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 5-(4-methylpiperidin-1-yl)sulfonyl-N-(3-phenylpropyl)-2,3-dihydro-1-benzofuran-2-carboxamide |
| SMILES | CC1CCN(S(=O)(=O)c2ccc3c(c2)CC(C(=O)NCCCc2ccccc2)O3)CC1 |
| InChI | InChI=1S/C24H30N2O4S/c1-18-11-14-26(15-12-18)31(28,29)21-9-10-22-20(16-21)17-23(30-22)24(27)25-13-5-8-19-6-3-2-4-7-19/h2-4,6-7,9-10,16,18,23H,5,8,11-15,17H2,1H3,(H,25,27) |
| InChIKey | HNDWTANUQNKPIP-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|