C20H24N4O — CID 70986115
9-[3-(3-oxopiperazin-1-yl)propyl]-5,6,7,8-tetrahydrocarbazole-3-carbonitrile (PubChem CID 70986115) has the molecular formula C20H24N4O and a molecular weight of 336.44 g/mol. Its IUPAC name is 9-[3-(3-oxopiperazin-1-yl)propyl]-5,6,7,8-tetrahydrocarbazole-3-carbonitrile.
| Compound Name | 9-[3-(3-oxopiperazin-1-yl)propyl]-5,6,7,8-tetrahydrocarbazole-3-carbonitrile |
|---|---|
| PubChem CID | 70986115 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 9-[3-(3-oxopiperazin-1-yl)propyl]-5,6,7,8-tetrahydrocarbazole-3-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)c1c(n2CCCN2CCNC(=O)C2)CCCC1 |
| InChI | InChI=1S/C20H24N4O/c21-13-15-6-7-19-17(12-15)16-4-1-2-5-18(16)24(19)10-3-9-23-11-8-22-20(25)14-23/h6-7,12H,1-5,8-11,14H2,(H,22,25) |
| InChIKey | KPIKOLXYFXAICB-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 61.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|