C15H14O6 — CID 70986389
dimethyl (10R)-4,6-dioxatetracyclo[7.4.0.03,7.010,13]trideca-1,3(7),8-triene-11,12-dicarboxylate (PubChem CID 70986389) has the molecular formula C15H14O6 and a molecular weight of 290.27 g/mol. Its IUPAC name is dimethyl (10R)-4,6-dioxatetracyclo[7.4.0.03,7.010,13]trideca-1,3(7),8-triene-11,12-dicarboxylate.
| Compound Name | dimethyl (10R)-4,6-dioxatetracyclo[7.4.0.03,7.010,13]trideca-1,3(7),8-triene-11,12-dicarboxylate |
|---|---|
| PubChem CID | 70986389 |
| Molecular Formula | C15H14O6 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | dimethyl (10R)-4,6-dioxatetracyclo[7.4.0.03,7.010,13]trideca-1,3(7),8-triene-11,12-dicarboxylate |
| SMILES | COC(=O)C1C(C(=O)OC)[C@@H]2c3cc4c(cc3C12)OCO4 |
| InChI | InChI=1S/C15H14O6/c1-18-14(16)12-10-6-3-8-9(21-5-20-8)4-7(6)11(10)13(12)15(17)19-2/h3-4,10-13H,5H2,1-2H3/t10-,11?,12?,13?/m1/s1 |
| InChIKey | CEGWXRXCYVNAMN-PEWWYSNMSA-N |
| XLogP | 1.19 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_465_misc(1)', 'substructure': 'N/A'} |
|---|