C21H38O2Si — CID 70986543
4,10,11,11-tetramethyl-2-triethylsilyloxytricyclo[5.3.1.01,5]undec-9-en-5-ol (PubChem CID 70986543) has the molecular formula C21H38O2Si and a molecular weight of 350.62 g/mol. Its IUPAC name is 4,10,11,11-tetramethyl-2-triethylsilyloxytricyclo[5.3.1.01,5]undec-9-en-5-ol.
| Compound Name | 4,10,11,11-tetramethyl-2-triethylsilyloxytricyclo[5.3.1.01,5]undec-9-en-5-ol |
|---|---|
| PubChem CID | 70986543 |
| Molecular Formula | C21H38O2Si |
| Molecular Weight | 350.62 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | 4,10,11,11-tetramethyl-2-triethylsilyloxytricyclo[5.3.1.01,5]undec-9-en-5-ol |
| SMILES | CC[Si](CC)(CC)OC1CC(C)C2(O)CC3CC=C(C)C12C3(C)C |
| InChI | InChI=1S/C21H38O2Si/c1-8-24(9-2,10-3)23-18-13-16(5)20(22)14-17-12-11-15(4)21(18,20)19(17,6)7/h11,16-18,22H,8-10,12-14H2,1-7H3 |
| InChIKey | SZJNSVNTIUGHAX-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.62 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|